EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H41N7O3 |
| Net Charge | 0 |
| Average Mass | 523.682 |
| Monoisotopic Mass | 523.32709 |
| SMILES | CCN(CC)CCCCNc1ncc2cc(-c3cc(OC)cc(OC)c3)c(NC(=O)NC(C)(C)C)nc2n1 |
| InChI | InChI=1S/C28H41N7O3/c1-8-35(9-2)13-11-10-12-29-26-30-18-20-16-23(19-14-21(37-6)17-22(15-19)38-7)25(31-24(20)32-26)33-27(36)34-28(3,4)5/h14-18H,8-13H2,1-7H3,(H3,29,30,31,32,33,34,36) |
| InChIKey | DXCUKNQANPLTEJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). fibroblast growth factor receptor antagonist An antagonist at the fibroblast growth factor receptor. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PD173074 (CHEBI:63448) has functional parent PD-166866 (CHEBI:156259) |
| PD173074 (CHEBI:63448) has role antineoplastic agent (CHEBI:35610) |
| PD173074 (CHEBI:63448) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| PD173074 (CHEBI:63448) has role fibroblast growth factor receptor antagonist (CHEBI:63457) |
| PD173074 (CHEBI:63448) is a aromatic amine (CHEBI:33860) |
| PD173074 (CHEBI:63448) is a biaryl (CHEBI:64459) |
| PD173074 (CHEBI:63448) is a dimethoxybenzene (CHEBI:51681) |
| PD173074 (CHEBI:63448) is a pyridopyrimidine (CHEBI:38932) |
| PD173074 (CHEBI:63448) is a tertiary amino compound (CHEBI:50996) |
| PD173074 (CHEBI:63448) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| 1-tert-butyl-3-[2-{[4-(diethylamino)butyl]amino}-6-(3,5-dimethoxyphenyl)pyrido[2,3-d]pyrimidin-7-yl]urea |
| Synonyms | Source |
|---|---|
| PD 173074 | ChEBI |
| PD-173074 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-1026 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10130688 | Reaxys |
| CAS:219580-11-7 | ChemIDplus |
| Citations |
|---|