EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24N6O3 |
| Net Charge | 0 |
| Average Mass | 396.451 |
| Monoisotopic Mass | 396.19099 |
| SMILES | COc1cc(OC)cc(-c2cc3cnc(N)nc3nc2NC(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C20H24N6O3/c1-20(2,3)26-19(27)25-17-15(8-12-10-22-18(21)24-16(12)23-17)11-6-13(28-4)9-14(7-11)29-5/h6-10H,1-5H3,(H4,21,22,23,24,25,26,27) |
| InChIKey | NHJSWORVNIOXIT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PD-166866 (CHEBI:156259) has role angiogenesis inhibitor (CHEBI:48422) |
| PD-166866 (CHEBI:156259) has role antineoplastic agent (CHEBI:35610) |
| PD-166866 (CHEBI:156259) has role apoptosis inducer (CHEBI:68495) |
| PD-166866 (CHEBI:156259) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| PD-166866 (CHEBI:156259) is a biaryl (CHEBI:64459) |
| PD-166866 (CHEBI:156259) is a dimethoxybenzene (CHEBI:51681) |
| PD-166866 (CHEBI:156259) is a primary arylamine (CHEBI:50471) |
| PD-166866 (CHEBI:156259) is a pyridopyrimidine (CHEBI:38932) |
| PD-166866 (CHEBI:156259) is a ureas (CHEBI:47857) |
| Incoming Relation(s) |
| PD173074 (CHEBI:63448) has functional parent PD-166866 (CHEBI:156259) |
| IUPAC Name |
|---|
| 1-[2-amino-6-(3,5-dimethoxyphenyl)pyrido[2,3-d]pyrimidin-7-yl]-3-tert-butylurea |
| Synonyms | Source |
|---|---|
| 1-[2-amino-6-(3,5-dimethoxyphenyl)-pyrido[2,3-d]pyrimidin-7-yl]-3-tert-butyl urea | ChEBI |
| N-[2-amino-6-(3,5-dimethoxyphenyl)pyrido[2,3-d]pyrimidin-7-yl]-N'-(1,1-dimethylethyl)-urea | ChEBI |
| PD 166866 | ChEBI |
| PD-166866 | ChemIDplus |
| PD166866 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:192705-79-6 | ChemIDplus |
| Citations |
|---|