EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15ClN2O2S |
| Net Charge | 0 |
| Average Mass | 358.850 |
| Monoisotopic Mass | 358.05428 |
| SMILES | Cc1ccc(-c2ncc(Cl)cc2-c2ccc(S(C)(=O)=O)cc2)cn1 |
| InChI | InChI=1S/C18H15ClN2O2S/c1-12-3-4-14(10-20-12)18-17(9-15(19)11-21-18)13-5-7-16(8-6-13)24(2,22)23/h3-11H,1-2H3 |
| InChIKey | MNJVRJDLRVPLFE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. |
| Application: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etoricoxib (CHEBI:6339) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| etoricoxib (CHEBI:6339) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| etoricoxib (CHEBI:6339) is a bipyridines (CHEBI:50511) |
| etoricoxib (CHEBI:6339) is a organochlorine compound (CHEBI:36683) |
| etoricoxib (CHEBI:6339) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| 5-chloro-6'-methyl-3-[4-(methylsulfonyl)phenyl]-2,3'-bipyridine |
| INNs | Source |
|---|---|
| etoricoxib | WHO MedNet |
| etoricoxib | ChemIDplus |
| étoricoxib | WHO MedNet |
| etoricoxibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 5-chloro-2-(6-methylpyridin-3-yl)-3-(4-(methylsulfonyl)phenyl)pyridine | ChEMBL |
| 5-Chloro-3-(4-methanesulfonyl-phenyl)-6'-methyl-[2,3']bipyridinyl | ChEMBL |
| 5-chloro-6'-methyl-3-(p-(methylsulfonyl)phenyl)-2,3'-bipyridine | ChemIDplus |
| Etoricoxib | KEGG COMPOUND |
| ETORICOXIB | ChEMBL |
| L791456 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:202409-33-4 | ChemIDplus |
| CAS:202409-33-4 | KEGG COMPOUND |
| Citations |
|---|