EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9O7P |
| Net Charge | -2 |
| Average Mass | 200.083 |
| Monoisotopic Mass | 200.00969 |
| SMILES | O=P([O-])([O-])OC[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C4H11O7P/c5-1-3(6)4(7)2-11-12(8,9)10/h3-7H,1-2H2,(H2,8,9,10)/p-2/t3-,4+/m1/s1 |
| InChIKey | QRDCEYBRRFPBMZ-DMTCNVIQSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-erythritol 1-phosphate(2−) (CHEBI:131849) is a organophosphate oxoanion (CHEBI:58945) |
| D-erythritol 1-phosphate(2−) (CHEBI:131849) is conjugate base of D-erythritol 1-phosphate (CHEBI:63319) |
| Incoming Relation(s) |
| D-erythritol 1-phosphate (CHEBI:63319) is conjugate acid of D-erythritol 1-phosphate(2−) (CHEBI:131849) |
| IUPAC Name |
|---|
| (2S,3R)-2,3,4-trihydroxybutyl phosphate |
| UniProt Name | Source |
|---|---|
| D-erythritol 1-phosphate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-19138 | MetaCyc |
| Citations |
|---|