EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N5O8P |
| Net Charge | -2 |
| Average Mass | 361.207 |
| Monoisotopic Mass | 361.04345 |
| SMILES | Nc1nc(=O)c2nc(=O)n([C@H]3C[C@H](O)[C@@H](COP(=O)([O-])[O-])O3)c2n1 |
| InChI | InChI=1S/C10H14N5O8P/c11-9-13-7-6(8(17)14-9)12-10(18)15(7)5-1-3(16)4(23-5)2-22-24(19,20)21/h3-5,16H,1-2H2,(H,12,18)(H2,19,20,21)(H3,11,13,14,17)/p-2/t3-,4+,5+/m0/s1 |
| InChIKey | AQIVLFLYHYFRKU-VPENINKCSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-oxo-dGMP(2−) (CHEBI:63224) is a organophosphate oxoanion (CHEBI:58945) |
| 8-oxo-dGMP(2−) (CHEBI:63224) is conjugate base of 8-oxo-dGMP (CHEBI:63223) |
| Incoming Relation(s) |
| 8-oxo-dGMP (CHEBI:63223) is conjugate acid of 8-oxo-dGMP(2−) (CHEBI:63224) |
| IUPAC Name |
|---|
| 2'-deoxy-8-oxo-5'-O-phosphonato-7,8-dihydroguanosine |
| UniProt Name | Source |
|---|---|
| 8-oxo-dGMP | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12365 | MetaCyc |
| Citations |
|---|