EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N5O8P |
| Net Charge | 0 |
| Average Mass | 363.223 |
| Monoisotopic Mass | 363.05800 |
| SMILES | Nc1nc(=O)c2nc(=O)n([C@H]3C[C@H](O)[C@@H](COP(=O)(O)O)O3)c2n1 |
| InChI | InChI=1S/C10H14N5O8P/c11-9-13-7-6(8(17)14-9)12-10(18)15(7)5-1-3(16)4(23-5)2-22-24(19,20)21/h3-5,16H,1-2H2,(H,12,18)(H2,19,20,21)(H3,11,13,14,17)/t3-,4+,5+/m0/s1 |
| InChIKey | AQIVLFLYHYFRKU-VPENINKCSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-oxo-dGMP (CHEBI:63223) is a purine 2'-deoxyribonucleoside 5'-monophosphate (CHEBI:36993) |
| 8-oxo-dGMP (CHEBI:63223) is conjugate acid of 8-oxo-dGMP(2−) (CHEBI:63224) |
| Incoming Relation(s) |
| 8-oxo-dGMP(2−) (CHEBI:63224) is conjugate base of 8-oxo-dGMP (CHEBI:63223) |
| IUPAC Name |
|---|
| 2'-deoxy-8-oxo-7,8-dihydroguanosine 5'-(dihydrogen phosphate) |
| Synonyms | Source |
|---|---|
| 2'-deoxy-7,8-dihydro-8-oxo-5'-guanylic acid | ChEBI |
| 2'-deoxy-7,8-dihydro-8-oxoguanosine 5'-monophosphate | ChEBI |
| 8-hydroxydeoxyguanosine 5'-monophosphate | ChemIDplus |
| 8-OH-Dgmp | ChemIDplus |
| 8-oxo-2'-deoxyguanosine-5'-monophosphate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-12365 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8588800 | Reaxys |
| CAS:127027-50-3 | ChemIDplus |
| Citations |
|---|