EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:63222 - 8-oxo-dGTP(3−)
| Formula | C10H13N5O14P3 |
| Net Charge | -3 |
| Average Mass | 520.157 |
| Monoisotopic Mass | 519.96883 |
| SMILES | Nc1nc(=O)c2nc(=O)n([C@H]3C[C@H](O)[C@@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])O)O3)c2n1 |
| InChI | InChI=1S/C10H16N5O14P3/c11-9-13-7-6(8(17)14-9)12-10(18)15(7)5-1-3(16)4(27-5)2-26-31(22,23)29-32(24,25)28-30(19,20)21/h3-5,16H,1-2H2,(H,12,18)(H,22,23)(H,24,25)(H2,19,20,21)(H3,11,13,14,17)/p-3/t3-,4+,5+/m0/s1 |
| InChIKey | BUZOGVVQWCXXDP-VPENINKCSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-oxo-dGTP(3−) (CHEBI:63222) is a 2'-deoxyribonucleoside triphosphate oxoanion (CHEBI:61662) |
| 8-oxo-dGTP(3−) (CHEBI:63222) is conjugate acid of 8-oxo-dGTP(4−) (CHEBI:77896) |
| 8-oxo-dGTP(3−) (CHEBI:63222) is conjugate base of 8-oxo-dGTP (CHEBI:63220) |
| Incoming Relation(s) |
| 8-oxo-dGTP (CHEBI:63220) is conjugate acid of 8-oxo-dGTP(3−) (CHEBI:63222) |
| 8-oxo-dGTP(4−) (CHEBI:77896) is conjugate base of 8-oxo-dGTP(3−) (CHEBI:63222) |
| IUPAC Name |
|---|
| 2'-deoxy-5'-O-[({[(hydroxyphosphinato)oxy]phosphinato}oxy)phosphinato]-8-oxo-7,8-dihydroguanosine |
| Synonyms | Source |
|---|---|
| 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-triphosphate(3−) | ChEBI |
| 8-oxo-7,8-dihydro-2'-dGTP(3−) | ChEBI |
| 8-oxodeoxyguanosine triphosphate(3−) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD0-1905 | MetaCyc |
| Citations |
|---|