EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N5O14P3 |
| Net Charge | 0 |
| Average Mass | 523.181 |
| Monoisotopic Mass | 522.99066 |
| SMILES | Nc1nc(=O)c2nc(=O)n([C@H]3C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O3)c2n1 |
| InChI | InChI=1S/C10H16N5O14P3/c11-9-13-7-6(8(17)14-9)12-10(18)15(7)5-1-3(16)4(27-5)2-26-31(22,23)29-32(24,25)28-30(19,20)21/h3-5,16H,1-2H2,(H,12,18)(H,22,23)(H,24,25)(H2,19,20,21)(H3,11,13,14,17)/t3-,4+,5+/m0/s1 |
| InChIKey | BUZOGVVQWCXXDP-VPENINKCSA-N |
| Roles Classification |
|---|
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-oxo-dGTP (CHEBI:63220) has role mutagen (CHEBI:25435) |
| 8-oxo-dGTP (CHEBI:63220) is a purine 2'-deoxyribonucleoside 5'-triphosphate (CHEBI:37042) |
| 8-oxo-dGTP (CHEBI:63220) is conjugate acid of 8-oxo-dGTP(3−) (CHEBI:63222) |
| Incoming Relation(s) |
| 8-oxo-dGTP(3−) (CHEBI:63222) is conjugate base of 8-oxo-dGTP (CHEBI:63220) |
| IUPAC Name |
|---|
| 2'-deoxy-8-oxo-7,8-dihydroguanosine 5'-(tetrahydrogen triphosphate) |
| Synonyms | Source |
|---|---|
| 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-triphosphate | ChemIDplus |
| 8-oxo-7,8-dihydro-2'-dGTP | MetaCyc |
| 8-oxodeoxyguanosine triphosphate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CPD0-1905 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8373155 | Reaxys |
| CAS:139307-94-1 | ChemIDplus |
| Citations |
|---|