EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12CCC(C)=C[C@@]1([H])[C@H](C(C)C)CCC2=C |
| InChI | InChI=1S/C15H24/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h9-10,13-15H,4-8H2,1-3H3/t13-,14-,15-/m0/s1 |
| InChIKey | WRHGORWNJGOVQY-KKUMJFAQSA-N |
| Roles Classification |
|---|
| Biological Role: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-γ-cadinene (CHEBI:63205) is a cadinene (CHEBI:22976) |
| (+)-γ-cadinene (CHEBI:63205) is a octahydronaphthalenes (CHEBI:138397) |
| (+)-γ-cadinene (CHEBI:63205) is a γ-cadinene (CHEBI:180496) |
| (+)-γ-cadinene (CHEBI:63205) is enantiomer of (−)-γ-cadinene (CHEBI:63203) |
| Incoming Relation(s) |
| (±)-γ-cadinene (CHEBI:59960) has part (+)-γ-cadinene (CHEBI:63205) |
| (−)-γ-cadinene (CHEBI:63203) is enantiomer of (+)-γ-cadinene (CHEBI:63205) |
| IUPAC Name |
|---|
| (1S,4aR,8aR)-7-methyl-4-methylidene-1-(propan-2-yl)-1,2,3,4,4a,5,6,8a-octahydronaphthalene |
| Synonyms | Source |
|---|---|
| epi-muurolene | ChemIDplus |
| D-γ-cadinene | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (+)-γ-cadinene | UniProt |
| Citations |
|---|