EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@]12CCC(C)=C[C@]1([H])[C@@H](C(C)C)CCC2=C |
| InChI | InChI=1S/C15H24/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h9-10,13-15H,4-8H2,1-3H3/t13-,14-,15-/m1/s1 |
| InChIKey | WRHGORWNJGOVQY-RBSFLKMASA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-γ-cadinene (CHEBI:63203) has role metabolite (CHEBI:25212) |
| (−)-γ-cadinene (CHEBI:63203) is a cadinene (CHEBI:22976) |
| (−)-γ-cadinene (CHEBI:63203) is a octahydronaphthalenes (CHEBI:138397) |
| (−)-γ-cadinene (CHEBI:63203) is a γ-cadinene (CHEBI:180496) |
| (−)-γ-cadinene (CHEBI:63203) is enantiomer of (+)-γ-cadinene (CHEBI:63205) |
| Incoming Relation(s) |
| (±)-γ-cadinene (CHEBI:59960) has part (−)-γ-cadinene (CHEBI:63203) |
| (+)-γ-cadinene (CHEBI:63205) is enantiomer of (−)-γ-cadinene (CHEBI:63203) |
| IUPAC Name |
|---|
| (1R,4aS,8aS)-7-methyl-4-methylidene-1-(propan-2-yl)-1,2,3,4,4a,5,6,8a-octahydronaphthalene |
| Synonym | Source |
|---|---|
| γ-cadinene | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (−)-γ-cadinene | UniProt |
| Citations |
|---|