EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12CC(C)(C)[C@@]1([H])CC/C(C)=C/CCC2=C |
| InChI | InChI=1S/C15H24/c1-11-6-5-7-12(2)13-10-15(3,4)14(13)9-8-11/h6,13-14H,2,5,7-10H2,1,3-4H3/b11-6+/t13-,14-/m0/s1 |
| InChIKey | NPNUFJAVOOONJE-IOMPXFEGSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-β-caryophyllene (CHEBI:63190) has role metabolite (CHEBI:25212) |
| (+)-β-caryophyllene (CHEBI:63190) is a β-caryophyllene (CHEBI:63191) |
| (+)-β-caryophyllene (CHEBI:63190) is enantiomer of (−)-β-caryophyllene (CHEBI:10357) |
| Incoming Relation(s) |
| (−)-β-caryophyllene (CHEBI:10357) is enantiomer of (+)-β-caryophyllene (CHEBI:63190) |
| IUPAC Name |
|---|
| (1S,4E,9R)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene |
| Synonyms | Source |
|---|---|
| (+)-caryophyllene | ChEBI |
| trans-(1S,9R)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undec-4-ene | ChEBI |
| UniProt Name | Source |
|---|---|
| (+)-(E)-β-caryophyllene | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6767547 | Reaxys |
| Citations |
|---|