EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12CC/C(C)=C/CCC(=C)[C@@]1([H])CC2(C)C |
| InChI | InChI=1S/C15H24/c1-11-6-5-7-12(2)13-10-15(3,4)14(13)9-8-11/h6,13-14H,2,5,7-10H2,1,3-4H3/b11-6+/t13-,14-/m1/s1 |
| InChIKey | NPNUFJAVOOONJE-GFUGXAQUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. insect attractant A chemical that attracts insects. |
| Applications: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-β-caryophyllene (CHEBI:10357) has role fragrance (CHEBI:48318) |
| (−)-β-caryophyllene (CHEBI:10357) has role insect attractant (CHEBI:24850) |
| (−)-β-caryophyllene (CHEBI:10357) has role metabolite (CHEBI:25212) |
| (−)-β-caryophyllene (CHEBI:10357) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| (−)-β-caryophyllene (CHEBI:10357) is a β-caryophyllene (CHEBI:63191) |
| (−)-β-caryophyllene (CHEBI:10357) is enantiomer of (+)-β-caryophyllene (CHEBI:63190) |
| Incoming Relation(s) |
| (+)-β-caryophyllene (CHEBI:63190) is enantiomer of (−)-β-caryophyllene (CHEBI:10357) |
| IUPAC Name |
|---|
| (1R,4E,9S)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene |
| Synonyms | Source |
|---|---|
| beta-Caryophyllene | KEGG COMPOUND |
| Caryophyllene | KEGG COMPOUND |
| trans-caryophyllene | ChEBI |
| trans-(1R,9S)-4,11,11-trimethyl-8-methylenebicyclo[7.2.0]undec-4-ene | ChEBI |
| caryophyllene | ChEBI |
| (E)-β-caryophyllene | MetaCyc |
| UniProt Name | Source |
|---|---|
| (−)-(E)-β-caryophyllene | UniProt |
| Citations |
|---|