EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24N2O3 |
| Net Charge | 0 |
| Average Mass | 352.434 |
| Monoisotopic Mass | 352.17869 |
| SMILES | [H][C@@]12C[C@@H]3C4[C@@H](OC(C)=O)[C@@]5(C[C@@H]4N1[C@@H](C)[C@@H]3CO)C2=Nc1ccccc15 |
| InChI | InChI=1S/C21H24N2O3/c1-10-13(9-24)12-7-16-19-21(14-5-3-4-6-15(14)22-19)8-17(23(10)16)18(12)20(21)26-11(2)25/h3-6,10,12-13,16-18,20,24H,7-9H2,1-2H3/t10-,12-,13-,16-,17-,18?,20+,21+/m0/s1 |
| InChIKey | XIMPCXFLDSKALH-FXRWJBKJSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| raucaffrinoline (CHEBI:63167) has parent hydride ajmalan (CHEBI:37673) |
| raucaffrinoline (CHEBI:63167) is a indole alkaloid (CHEBI:38958) |
| IUPAC Name |
|---|
| (6S,8S,9R,10S,11aS,12aR)-9-(hydroxymethyl)-8-methyl-8,9,10,11,11a,12-hexahydro-6H-6,10:11,12a-dimethanoindolo[3,2-b]quinolizin-13-yl acetate |
| Synonym | Source |
|---|---|
| (17R,20α,21β)-1,2-didehydro-1-demethyl-19-hydroxy-21-methyl-18-norajmalan-17-yl acetate | IUBMB |
| UniProt Name | Source |
|---|---|
| raucaffrinoline | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7002801 | Reaxys |
| Reaxys:9294799 | Reaxys |
| Citations |
|---|