EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26N2 |
| Net Charge | 0 |
| Average Mass | 294.442 |
| Monoisotopic Mass | 294.20960 |
| SMILES | [H][C@@]12N(C)c3ccccc3[C@@]13CC1[C@H](C3)N3C[C@@H](CC)[C@]1([H])C[C@]32[H] |
| InChI | InChI=1S/C20H26N2/c1-3-12-11-22-17-8-13(12)14-9-20(10-18(14)22)15-6-4-5-7-16(15)21(2)19(17)20/h4-7,12-14,17-19H,3,8-11H2,1-2H3/t12-,13+,14?,17+,18+,19+,20+/m1/s1 |
| InChIKey | AJONLKUQHMDAFG-PAPVJSBLSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ajmalan (CHEBI:37673) is a indole alkaloid (CHEBI:38958) |
| ajmalan (CHEBI:37673) is a indole alkaloid fundamental parent (CHEBI:38482) |
| Incoming Relation(s) |
| ajmaline (CHEBI:28462) has parent hydride ajmalan (CHEBI:37673) |
| perakine (CHEBI:63168) has parent hydride ajmalan (CHEBI:37673) |
| raucaffrinoline (CHEBI:63167) has parent hydride ajmalan (CHEBI:37673) |
| IUPAC Name |
|---|
| ajmalan |
| Registry Numbers | Sources |
|---|---|
| Beilstein:893162 | Beilstein |