EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C2H4O)m.(C3H6O)l.(C3H6O)n.C3H10N2 |
| Net Charge | 0 |
| Average Mass | 234.340 |
| Monoisotopic Mass | 234.19434 |
| SMILES | CC(N)COCCOC(C)COCC(C)N |
| InChI | InChI=1S/C11H26N2O3/c1-9(12)6-14-4-5-16-11(3)8-15-7-10(2)13/h9-11H,4-8,12-13H2,1-3H3 |
| InChIKey | RDSVPKGMYHANML-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | crystallisation adjutant Chemical role played by a material when used to promote crystallisation. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Jeffamine ED-2001 (CHEBI:63052) has role crystallisation adjutant (CHEBI:63064) |
| Jeffamine ED-2001 (CHEBI:63052) is a diamine (CHEBI:23666) |
| Jeffamine ED-2001 (CHEBI:63052) is a jeffamine diamine (CHEBI:63066) |
| Jeffamine ED-2001 (CHEBI:63052) is a polyether (CHEBI:46774) |
| Synonym | Source |
|---|---|
| O,O'-bis(2-aminopropyl) polypropylene glycol-block-polyethylene glycol-block-polypropylene glycol | ChEBI |