EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H34FeN4O4 |
| Net Charge | -2 |
| Average Mass | 606.504 |
| Monoisotopic Mass | 606.19404 |
| SMILES | CC1=C(CCC(=O)[O-])C2=Cc3c(CCC(=O)[O-])c(C)c4[n]3[Fe-2]35[n]6c(c(C)c(C)c6=CC6=[N+]3C(=C4)C(C)(C)C6C)=CC1=[N+]25 |
| InChI | InChI=1S/C33H38N4O4.Fe/c1-16-17(2)24-13-27-20(5)33(6,7)30(37-27)15-26-19(4)22(9-11-32(40)41)29(36-26)14-28-21(8-10-31(38)39)18(3)25(35-28)12-23(16)34-24;/h12-15,20H,8-11H2,1-7H3,(H4,34,35,36,37,38,39,40,41);/q;+2/p-4 |
| InChIKey | ZJLLQWSACVGYEC-UHFFFAOYSA-J |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iron methylchlorin(2−) (CHEBI:62807) is a dicarboxylic acid dianion (CHEBI:28965) |
| iron methylchlorin(2−) (CHEBI:62807) is conjugate base of iron methylchlorin (CHEBI:62806) |
| Incoming Relation(s) |
| iron methylchlorin (CHEBI:62806) is conjugate acid of iron methylchlorin(2−) (CHEBI:62807) |
| Citations |
|---|