EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H36FeN4O4 |
| Net Charge | 0 |
| Average Mass | 608.520 |
| Monoisotopic Mass | 608.20859 |
| SMILES | CC1=C(CCC(=O)O)C2=Cc3c(CCC(=O)O)c(C)c4[n]3[Fe-2]35[n]6c(c(C)c(C)c6=CC6=[N+]3C(=C4)C(C)(C)C6C)=CC1=[N+]25 |
| InChI | InChI=1S/C33H38N4O4.Fe/c1-16-17(2)24-13-27-20(5)33(6,7)30(37-27)15-26-19(4)22(9-11-32(40)41)29(36-26)14-28-21(8-10-31(38)39)18(3)25(35-28)12-23(16)34-24;/h12-15,20H,8-11H2,1-7H3,(H4,34,35,36,37,38,39,40,41);/q;+2/p-2 |
| InChIKey | ZJLLQWSACVGYEC-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. prosthetic group A tightly bound, specific nonpolypeptide unit in a protein determining and involved in its biological activity. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iron methylchlorin (CHEBI:62806) is a dicarboxylic acid (CHEBI:35692) |
| iron methylchlorin (CHEBI:62806) is a ferroheme (CHEBI:38573) |
| iron methylchlorin (CHEBI:62806) is a metallochlorin (CHEBI:62804) |
| iron methylchlorin (CHEBI:62806) is conjugate acid of iron methylchlorin(2−) (CHEBI:62807) |
| Incoming Relation(s) |
| iron methylchlorin(2−) (CHEBI:62807) is conjugate base of iron methylchlorin (CHEBI:62806) |
| IUPAC Name |
|---|
| [3,3'-(3,7,7,8,12,13,17-heptamethyl-7,8-dihydroporphyrin-2,18-diyl-κ4N21,N22,N23,N24)dipropanoato(2−)]iron |
| Citations |
|---|