EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5O6 |
| Net Charge | -3 |
| Average Mass | 173.100 |
| Monoisotopic Mass | 173.01026 |
| SMILES | O=C([O-])CC(CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C6H8O6/c7-4(8)1-3(6(11)12)2-5(9)10/h3H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/p-3 |
| InChIKey | KQTIIICEAUMSDG-UHFFFAOYSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tricarballylate (CHEBI:62517) is a tricarboxylic acid trianion (CHEBI:27092) |
| tricarballylate (CHEBI:62517) is conjugate base of tricarballylic acid (CHEBI:45969) |
| Incoming Relation(s) |
| tricarballylic acid (CHEBI:45969) is conjugate acid of tricarballylate (CHEBI:62517) |
| IUPAC Name |
|---|
| propane-1,2,3-tricarboxylate |
| Synonyms | Source |
|---|---|
| 1,2,3-propanetricarboxylate | ChEBI |
| tricarballylic acid(3−) | ChEBI |
| UniProt Name | Source |
|---|---|
| tricarballylate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-3571 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3958837 | Reaxys |
| Citations |
|---|