EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O6 |
| Net Charge | 0 |
| Average Mass | 176.124 |
| Monoisotopic Mass | 176.03209 |
| SMILES | O=C(O)CC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H8O6/c7-4(8)1-3(6(11)12)2-5(9)10/h3H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | KQTIIICEAUMSDG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tricarballylic acid (CHEBI:45969) is a tricarboxylic acid (CHEBI:27093) |
| tricarballylic acid (CHEBI:45969) is conjugate acid of tricarballylate (CHEBI:62517) |
| Incoming Relation(s) |
| fumonisin (CHEBI:38224) has functional parent tricarballylic acid (CHEBI:45969) |
| tricarballylate (CHEBI:62517) is conjugate base of tricarballylic acid (CHEBI:45969) |
| IUPAC Name |
|---|
| propane-1,2,3-tricarboxylic acid |
| Synonyms | Source |
|---|---|
| TRICARBALLYLIC ACID | PDBeChem |
| β-carboxyglutaric acid | ChemIDplus |
| 1,2,3-propanetricarboxylic acid | ChemIDplus |
| carboxymethylsuccinic acid | ChEBI |
| 3-carboxyglutaric acid | ChEBI |
| 3-carboxypentanedioic acid | ChEBI |
| Citations |
|---|