EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11NO2 |
| Net Charge | 0 |
| Average Mass | 141.170 |
| Monoisotopic Mass | 141.07898 |
| SMILES | [H][C@@]1(C[C@H](N)C(=O)O)CC1=C |
| InChI | InChI=1S/C7H11NO2/c1-4-2-5(4)3-6(8)7(9)10/h5-6H,1-3,8H2,(H,9,10)/t5-,6-/m0/s1 |
| InChIKey | OOJZCXFXPZGUBJ-WDSKDSINSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Blighia sapida (ncbitaxon:259381) | fruit (BTO:0000486) | PubMed (19653254f) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | phytotoxin Any toxin produced by a plant. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S,4S)-hypoglycin A (CHEBI:6248) has role phytotoxin (CHEBI:38231) |
| (2S,4S)-hypoglycin A (CHEBI:6248) has role plant metabolite (CHEBI:76924) |
| (2S,4S)-hypoglycin A (CHEBI:6248) is a 2-amino-3-(2-methylenecyclopropyl)propanoic acid (CHEBI:136270) |
| (2S,4S)-hypoglycin A (CHEBI:6248) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Incoming Relation(s) |
| (2S,4S)-hypoglycin B (CHEBI:6332) has functional parent (2S,4S)-hypoglycin A (CHEBI:6248) |
| hypoglycin A (CHEBI:134622) has part (2S,4S)-hypoglycin A (CHEBI:6248) |
| IUPAC Name |
|---|
| 3-[(1S)-2-methylenecyclopropyl]-L-alanine |
| Synonyms | Source |
|---|---|
| (+)-hypoglycin A | ChEBI |
| L-Hypoglycin | KEGG COMPOUND |