EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11NO2 |
| Net Charge | 0 |
| Average Mass | 141.170 |
| Monoisotopic Mass | 141.07898 |
| SMILES | C=C1CC1CC(N)C(=O)O |
| InChI | InChI=1S/C7H11NO2/c1-4-2-5(4)3-6(8)7(9)10/h5-6H,1-3,8H2,(H,9,10) |
| InChIKey | OOJZCXFXPZGUBJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-3-(2-methylenecyclopropyl)propanoic acid (CHEBI:136270) is a cyclopropanes (CHEBI:51454) |
| 2-amino-3-(2-methylenecyclopropyl)propanoic acid (CHEBI:136270) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 2-amino-3-(2-methylenecyclopropyl)propanoic acid (CHEBI:136270) is a olefinic compound (CHEBI:78840) |
| Incoming Relation(s) |
| (2S,4R)-hypoglycin A (CHEBI:134620) is a 2-amino-3-(2-methylenecyclopropyl)propanoic acid (CHEBI:136270) |
| (2S,4S)-hypoglycin A (CHEBI:6248) is a 2-amino-3-(2-methylenecyclopropyl)propanoic acid (CHEBI:136270) |
| IUPAC Name |
|---|
| 3-(2-methylenecyclopropyl)alanine |
| Synonyms | Source |
|---|---|
| 2-amino-3-(2-methylenecyclopropyl)propanoic acid | IUPAC |
| 2-amino-3-(2-methylenecyclopropyl)propionic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-9699 | MetaCyc |