EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O9 |
| Net Charge | 0 |
| Average Mass | 426.462 |
| Monoisotopic Mass | 426.18898 |
| SMILES | CC1=CC(=O)CC(C)(C)[C@@]1(O)/C=C/C(C)=C/C(=O)OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H30O9/c1-11(5-6-21(28)12(2)8-13(23)9-20(21,3)4)7-15(24)30-19-18(27)17(26)16(25)14(10-22)29-19/h5-8,14,16-19,22,25-28H,9-10H2,1-4H3/b6-5+,11-7+/t14-,16-,17+,18-,19?,21-/m1/s1 |
| InChIKey | HLVPIMVSSMJFPS-SHYSOILJSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-2-trans-abscisic acid D-glucopyranosyl ester (CHEBI:62438) has functional parent (S)-2-trans-abscisic acid (CHEBI:18743) |
| (S)-2-trans-abscisic acid D-glucopyranosyl ester (CHEBI:62438) is a 2-trans-abscisic acid D-glucosyl ester (CHEBI:133910) |
| Incoming Relation(s) |
| (S)-2-trans-abscisic acid β-D-glucopyranosyl ester (CHEBI:62437) is a (S)-2-trans-abscisic acid D-glucopyranosyl ester (CHEBI:62438) |
| Synonyms | Source |
|---|---|
| 1-O-{(2E,4S)-5-[(1S)-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoyl}-D-glucopyranose | ChEBI |
| 2-trans-(+)-ABA-GE | ChEBI |
| UniProt Name | Source |
|---|---|
| (S)-2-trans-abscisic acid D-glucopyranosyl ester | UniProt |
| Citations |
|---|