EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O4 |
| Net Charge | 0 |
| Average Mass | 264.321 |
| Monoisotopic Mass | 264.13616 |
| SMILES | CC1=CC(=O)CC(C)(C)[C@@]1(O)/C=C/C(C)=C/C(=O)O |
| InChI | InChI=1S/C15H20O4/c1-10(7-13(17)18)5-6-15(19)11(2)8-12(16)9-14(15,3)4/h5-8,19H,9H2,1-4H3,(H,17,18)/b6-5+,10-7+/t15-/m1/s1 |
| InChIKey | JLIDBLDQVAYHNE-IBPUIESWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-2-trans-abscisic acid (CHEBI:18743) is a 2-trans-abscisic acid (CHEBI:62426) |
| (S)-2-trans-abscisic acid (CHEBI:18743) is conjugate acid of (S)-2-trans-abscisate (CHEBI:62421) |
| (S)-2-trans-abscisic acid (CHEBI:18743) is enantiomer of (R)-2-trans-abscisic acid (CHEBI:18657) |
| Incoming Relation(s) |
| (S)-2-trans-abscisic acid D-glucopyranosyl ester (CHEBI:62438) has functional parent (S)-2-trans-abscisic acid (CHEBI:18743) |
| (S)-2-trans-abscisic acid β-D-glucopyranosyl ester (CHEBI:62437) has functional parent (S)-2-trans-abscisic acid (CHEBI:18743) |
| (S)-2-trans-abscisate (CHEBI:62421) is conjugate base of (S)-2-trans-abscisic acid (CHEBI:18743) |
| (R)-2-trans-abscisic acid (CHEBI:18657) is enantiomer of (S)-2-trans-abscisic acid (CHEBI:18743) |
| IUPAC Name |
|---|
| (2E,4E)-5-[(1S)-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
| Synonyms | Source |
|---|---|
| (S)-2-trans-abscisic acid | ChEBI |
| (7E,9E)-(6S)-6-hydroxy-3-oxo-11-apo-ε-caroten-11-oic acid | JCBN |
| 2-trans-(+)-ABA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPR0103050001 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3034278 | Reaxys |
| Citations |
|---|