EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H8N2O2 |
| Net Charge | 0 |
| Average Mass | 224.219 |
| Monoisotopic Mass | 224.05858 |
| SMILES | O=C(O)c1cccc2nc3ccccc3nc12 |
| InChI | InChI=1S/C13H8N2O2/c16-13(17)8-4-3-7-11-12(8)15-10-6-2-1-5-9(10)14-11/h1-7H,(H,16,17) |
| InChIKey | JGCSKOVQDXEQHI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenazine-1-carboxylic acid (CHEBI:62412) has role antifungal agent (CHEBI:35718) |
| phenazine-1-carboxylic acid (CHEBI:62412) has role antimicrobial agent (CHEBI:33281) |
| phenazine-1-carboxylic acid (CHEBI:62412) has role bacterial metabolite (CHEBI:76969) |
| phenazine-1-carboxylic acid (CHEBI:62412) is a aromatic carboxylic acid (CHEBI:33859) |
| phenazine-1-carboxylic acid (CHEBI:62412) is a monocarboxylic acid (CHEBI:25384) |
| phenazine-1-carboxylic acid (CHEBI:62412) is a phenazines (CHEBI:39201) |
| phenazine-1-carboxylic acid (CHEBI:62412) is conjugate acid of phenazine-1-carboxylate (CHEBI:62248) |
| Incoming Relation(s) |
| phenazine-1-carboxylate (CHEBI:62248) is conjugate base of phenazine-1-carboxylic acid (CHEBI:62412) |
| Synonyms | Source |
|---|---|
| 1-Carboxylic acid phenazine | ChemIDplus |
| 1-carboxyphenazine | ChEBI |
| 1-Phenazinecarboxylic acid | ChemIDplus |
| Phenazin-1-carbonsäure | ChEBI |
| Phenazinecarboxylic acid | ChemIDplus |
| Citations |
|---|