EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:62412 - phenazine-1-carboxylic acid
| Formula | C13H8N2O2 |
| Net Charge | 0 |
| Average Mass | 224.219 |
| Monoisotopic Mass | 224.05858 |
| SMILES | O=C(O)c1cccc2nc3ccccc3nc12 |
| InChI | InChI=1S/C13H8N2O2/c16-13(17)8-4-3-7-11-12(8)15-10-6-2-1-5-9(10)14-11/h1-7H,(H,16,17) |
| InChIKey | JGCSKOVQDXEQHI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenazine-1-carboxylic acid (CHEBI:62412) has role antifungal agent (CHEBI:35718) |
| phenazine-1-carboxylic acid (CHEBI:62412) has role antimicrobial agent (CHEBI:33281) |
| phenazine-1-carboxylic acid (CHEBI:62412) has role bacterial metabolite (CHEBI:76969) |
| phenazine-1-carboxylic acid (CHEBI:62412) is a aromatic carboxylic acid (CHEBI:33859) |
| phenazine-1-carboxylic acid (CHEBI:62412) is a monocarboxylic acid (CHEBI:25384) |
| phenazine-1-carboxylic acid (CHEBI:62412) is a phenazines (CHEBI:39201) |
| phenazine-1-carboxylic acid (CHEBI:62412) is conjugate acid of phenazine-1-carboxylate (CHEBI:62248) |
| Incoming Relation(s) |
| phenazine-1-carboxylate (CHEBI:62248) is conjugate base of phenazine-1-carboxylic acid (CHEBI:62412) |
| Synonyms | Source |
|---|---|
| 1-carboxyphenazine | ChEBI |
| 1-Phenazinecarboxylic acid | ChemIDplus |
| Phenazin-1-carbonsäure | ChEBI |
| Phenazinecarboxylic acid | ChemIDplus |
| 1-Carboxylic acid phenazine | ChemIDplus |
| Citations |
|---|