EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O11 |
| Net Charge | 0 |
| Average Mass | 342.297 |
| Monoisotopic Mass | 342.11621 |
| SMILES | OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O)O[C@H](CO)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O |
| WURCS | WURCS=2.0/2,2,1/[a2112h-1b_1-5][a2112h-1a_1-5]/1-2/a3-b1 |
| InChI | InChI=1S/C12H22O11/c13-1-3-5(15)7(17)8(18)12(22-3)23-10-6(16)4(2-14)21-11(20)9(10)19/h3-20H,1-2H2/t3-,4-,5+,6+,7+,8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | QIGJYVCQYDKYDW-VZGRRIPQSA-N |
| Roles Classification |
|---|
| Biological Roles: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). carbohydrate allergen Any carbohydrate, carbohydrate derivative or derived substituent group which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-D-Galp-(1→3)-β-D-Galp (CHEBI:62330) is a α-D-galactosyl-(1→3)-D-galactose (CHEBI:53651) |
| Incoming Relation(s) |
| α-D-Galp-(1→6)-α-D-Galp-(1→3)-β-D-Galp (CHEBI:148815) has functional parent α-D-Galp-(1→3)-β-D-Galp (CHEBI:62330) |
| β-D-Galp-(1→4)-α-D-Galp-(1→3)-β-D-Galp (CHEBI:149159) has functional parent α-D-Galp-(1→3)-β-D-Galp (CHEBI:62330) |
| IUPAC Name |
|---|
| α-D-galactopyranosyl-(1→3)-β-D-galactopyranose |
| Synonyms | Source |
|---|---|
| 3-O-α-D-galactopyranosyl-β-D-galactopyranose | IUPAC |
| Gala1-3Galb | ChEBI |
| Galα1-3Galβ | ChEBI |
| αGal(1→3)βGal | ChEBI |
| αGal1-3βGal | ChEBI |
| α-D-Gal-(1→3)-β-D-Gal | ChEBI |
| Citations |
|---|