EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:53651 - α-D-galactosyl-(1→3)-D-galactose
| Formula | C12H22O11 |
| Net Charge | 0 |
| Average Mass | 342.297 |
| Monoisotopic Mass | 342.11621 |
| SMILES | OC[C@H]1O[C@H](O[C@H]2[C@@H](O)[C@@H](CO)OC(O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O |
| WURCS | WURCS=2.0/2,2,1/[a2112h-1x_1-5][a2112h-1a_1-5]/1-2/a3-b1 |
| InChI | InChI=1S/C12H22O11/c13-1-3-5(15)7(17)8(18)12(22-3)23-10-6(16)4(2-14)21-11(20)9(10)19/h3-20H,1-2H2/t3-,4-,5+,6+,7+,8-,9-,10+,11?,12-/m1/s1 |
| InChIKey | QIGJYVCQYDKYDW-SDOYDPJRSA-N |
| Roles Classification |
|---|
| Biological Roles: | carbohydrate allergen Any carbohydrate, carbohydrate derivative or derived substituent group which causes the onset of an allergic reaction. antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-D-galactosyl-(1→3)-D-galactose (CHEBI:53651) has role antigen (CHEBI:59132) |
| α-D-galactosyl-(1→3)-D-galactose (CHEBI:53651) has role carbohydrate allergen (CHEBI:143231) |
| α-D-galactosyl-(1→3)-D-galactose (CHEBI:53651) has role epitope (CHEBI:53000) |
| α-D-galactosyl-(1→3)-D-galactose (CHEBI:53651) is a galactobiose (CHEBI:167122) |
| Incoming Relation(s) |
| β-D-Galp-(1→4)-α-D-Galp-(1→3)-D-Galp (CHEBI:148482) has functional parent α-D-galactosyl-(1→3)-D-galactose (CHEBI:53651) |
| α-(1→3)-galactobiose (CHEBI:60180) is a α-D-galactosyl-(1→3)-D-galactose (CHEBI:53651) |
| α-D-Galp-(1→3)-β-D-Galp (CHEBI:62330) is a α-D-galactosyl-(1→3)-D-galactose (CHEBI:53651) |
| α-D-galactosyl-(1→3)-D-galactosyl group (CHEBI:59095) is substituent group from α-D-galactosyl-(1→3)-D-galactose (CHEBI:53651) |
| IUPAC Name |
|---|
| α-D-galactopyranosyl-(1→3)-D-galactose |
| Synonyms | Source |
|---|---|
| Galα1,3Gal | ChEBI |
| 3-O-α-D-Galactopyranosyl-D-galactose | IUPAC |
| galactose-α-1,3-galactose | ChEBI |
| α-D-Galp-(1→3)-D-Galp | ChEBI |
| α-D-Gal-(1→3)-D-Gal | ChEBI |
| (Gal)2 | KEGG GLYCAN |
| Citations |
|---|