EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N2O2 |
| Net Charge | +1 |
| Average Mass | 181.215 |
| Monoisotopic Mass | 181.09715 |
| SMILES | Nc1ccc(O)cc1C(=O)CC[NH3+] |
| InChI | InChI=1S/C9H12N2O2/c10-4-3-9(13)7-5-6(12)1-2-8(7)11/h1-2,5,12H,3-4,10-11H2/p+1 |
| InChIKey | JANBBPTXDKFOQR-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxykynurenaminium(1+) (CHEBI:62214) is a ammonium ion derivative (CHEBI:35274) |
| 5-hydroxykynurenaminium(1+) (CHEBI:62214) is conjugate acid of 5-hydroxykynurenamine (CHEBI:28715) |
| Incoming Relation(s) |
| 5-hydroxykynurenamine (CHEBI:28715) is conjugate base of 5-hydroxykynurenaminium(1+) (CHEBI:62214) |
| IUPAC Name |
|---|
| 3-(2-amino-5-hydroxyphenyl)-3-oxopropan-1-aminium |
| Synonyms | Source |
|---|---|
| 5-hydroxykynurenamine(1+) | ChEBI |
| 5-hydroxykynurenaminium cation | ChEBI |
| UniProt Name | Source |
|---|---|
| 5-hydroxykynurenamine | UniProt |