EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28715 - 5-hydroxykynurenamine
| Formula | C9H12N2O2 |
| Net Charge | 0 |
| Average Mass | 180.207 |
| Monoisotopic Mass | 180.08988 |
| SMILES | NCCC(=O)c1cc(O)ccc1N |
| InChI | InChI=1S/C9H12N2O2/c10-4-3-9(13)7-5-6(12)1-2-8(7)11/h1-2,5,12H,3-4,10-11H2 |
| InChIKey | JANBBPTXDKFOQR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxykynurenamine (CHEBI:28715) has role mouse metabolite (CHEBI:75771) |
| 5-hydroxykynurenamine (CHEBI:28715) is a hydroxykynurenamine (CHEBI:24705) |
| 5-hydroxykynurenamine (CHEBI:28715) is a primary amino compound (CHEBI:50994) |
| 5-hydroxykynurenamine (CHEBI:28715) is conjugate base of 5-hydroxykynurenaminium(1+) (CHEBI:62214) |
| Incoming Relation(s) |
| formyl-5-hydroxykynurenamine (CHEBI:28736) has functional parent 5-hydroxykynurenamine (CHEBI:28715) |
| 5-hydroxykynurenaminium(1+) (CHEBI:62214) is conjugate acid of 5-hydroxykynurenamine (CHEBI:28715) |
| Synonyms | Source |
|---|---|
| 3-Amino-1-(2-amino-5-hydroxyphenyl)-1-propanone | ChemIDplus |
| 5-Hydroxykynurenamine | KEGG COMPOUND |
| Mausamine | ChemIDplus |
| Mousamine | ChemIDplus |
| Citations |
|---|