EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19NO10 |
| Net Charge | 0 |
| Average Mass | 325.270 |
| Monoisotopic Mass | 325.10090 |
| SMILES | [H][C@@]1([C@H](O)[C@H](O)CO)O[C@](O)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO |
| InChI | InChI=1S/C11H19NO10/c13-2-5(16)8(18)9-7(12-6(17)3-14)4(15)1-11(21,22-9)10(19)20/h4-5,7-9,13-16,18,21H,1-3H2,(H,12,17)(H,19,20)/t4-,5+,7+,8+,9+,11-/m0/s1 |
| InChIKey | FDJKUWYYUZCUJX-AJKRCSPLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-glycoloyl-β-neuraminic acid (CHEBI:62084) has role antigen (CHEBI:59132) |
| N-glycoloyl-β-neuraminic acid (CHEBI:62084) has role mammalian metabolite (CHEBI:75768) |
| N-glycoloyl-β-neuraminic acid (CHEBI:62084) is a N-glycoloylneuraminic acid (CHEBI:146193) |
| IUPAC Name |
|---|
| 3,5-dideoxy-5-(glycoloylamino)-D-glycero-β-D-galacto-non-2-ulopyranosonic acid |
| Synonyms | Source |
|---|---|
| NGNA | ChemIDplus |
| Neu5Gc | ChEBI |
| N-Glycolylneuraminic acid | ChemIDplus |
| GcNeu | ChemIDplus |
| NeuGc | ChEBI |
| N-glycolyl-β-neuraminic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000833 | HMDB |
| N-Glycolylneuraminic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8136953 | Reaxys |
| CAS:1113-83-3 | ChemIDplus |
| Citations |
|---|