EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C14H19NO14S)n.H2O |
| Net Charge | -2 |
| Average Mass | 475.381 |
| Monoisotopic Mass | 475.06429 |
| SMILES | [H]O[C@@H]1O[C@H](COS(=O)(=O)[O-])[C@H](O)[C@H](O[C@@H]2O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]2O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C14H23NO15S/c1-3(16)15-5-10(6(17)4(28-13(5)23)2-27-31(24,25)26)29-14-9(20)7(18)8(19)11(30-14)12(21)22/h4-11,13-14,17-20,23H,2H2,1H3,(H,15,16)(H,21,22)(H,24,25,26)/p-2/t4-,5-,6+,7+,8+,9-,10-,11+,13-,14-/m1/s1 |
| InChIKey | HMCUNCSRFXXUOR-YHCGEDBISA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chondroitin 6'-sulfate anion (CHEBI:62065) has functional parent chondroitin D-glucuronate anion (CHEBI:57652) |
| chondroitin 6'-sulfate anion (CHEBI:62065) is a polysaccharide acid oxoanion (CHEBI:62196) |
| chondroitin 6'-sulfate anion (CHEBI:62065) is conjugate base of chondroitin 6'-sulfate (CHEBI:18296) |
| Incoming Relation(s) |
| chondroitin 4',6'-disulfate anion (CHEBI:138112) has functional parent chondroitin 6'-sulfate anion (CHEBI:62065) |
| chondroitin 6'-sulfate (CHEBI:18296) is conjugate acid of chondroitin 6'-sulfate anion (CHEBI:62065) |
| Synonyms | Source |
|---|---|
| chondroitin 6'-sulfate polyanion | ChEBI |
| chondroitin sulfate C anion | SUBMITTER |
| chondroitin sulfate C polyanion | ChEBI |
| UniProt Name | Source |
|---|---|
| chondroitin 6'-sulfate | UniProt |