EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C14H20NO11)n.H2O |
| Net Charge | -1 |
| Average Mass | 396.325 |
| Monoisotopic Mass | 396.11475 |
| SMILES | [H]O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O[C@@H]2O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]2O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C14H23NO12/c1-3(17)15-5-10(6(18)4(2-16)25-13(5)24)26-14-9(21)7(19)8(20)11(27-14)12(22)23/h4-11,13-14,16,18-21,24H,2H2,1H3,(H,15,17)(H,22,23)/p-1/t4-,5-,6+,7+,8+,9-,10-,11+,13-,14-/m1/s1 |
| InChIKey | LJORHONFMDUUHP-YHCGEDBISA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chondroitin D-glucuronate anion (CHEBI:57652) is a polyanionic polymer (CHEBI:61469) |
| chondroitin D-glucuronate anion (CHEBI:57652) is conjugate base of chondroitin D-glucuronate (CHEBI:16137) |
| Incoming Relation(s) |
| chondroitin 6'-sulfate anion (CHEBI:62065) has functional parent chondroitin D-glucuronate anion (CHEBI:57652) |
| chondroitin sulfate E anion (CHEBI:62063) has functional parent chondroitin D-glucuronate anion (CHEBI:57652) |
| chondroitin D-glucuronate (CHEBI:16137) is conjugate acid of chondroitin D-glucuronate anion (CHEBI:57652) |
| Synonym | Source |
|---|---|
| chondroitin D-glucuronate polyanion | ChEBI |
| UniProt Name | Source |
|---|---|
| chondroitin D-glucuronate | UniProt |