EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34O4S |
| Net Charge | 0 |
| Average Mass | 418.599 |
| Monoisotopic Mass | 418.21778 |
| SMILES | [H][C@]12CC[C@]3(C)[C@@H](C(C)=O)CC[C@@]3([H])[C@]1([H])[C@H](SCCC(=O)O)CC1=CC(=O)CC[C@@]12C |
| InChI | InChI=1S/C24H34O4S/c1-14(25)17-4-5-18-22-19(7-10-24(17,18)3)23(2)9-6-16(26)12-15(23)13-20(22)29-11-8-21(27)28/h12,17-20,22H,4-11,13H2,1-3H3,(H,27,28)/t17-,18+,19+,20-,22+,23+,24-/m1/s1 |
| InChIKey | BOJZZBMFGDYFER-WTBIUSKOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(progesterone-7α-yl)thiopropionic acid (CHEBI:62023) has functional parent progesterone (CHEBI:17026) |
| 3-(progesterone-7α-yl)thiopropionic acid (CHEBI:62023) is a 20-oxo steroid (CHEBI:36885) |
| 3-(progesterone-7α-yl)thiopropionic acid (CHEBI:62023) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| 3-(progesterone-7α-yl)thiopropionic acid (CHEBI:62023) is a monocarboxylic acid (CHEBI:25384) |
| 3-(progesterone-7α-yl)thiopropionic acid (CHEBI:62023) is a steroid acid (CHEBI:47891) |
| 3-(progesterone-7α-yl)thiopropionic acid (CHEBI:62023) is a steroid sulfide (CHEBI:62027) |
| IUPAC Name |
|---|
| 3-{[(7α)-3,20-dioxopregn-4-en-7-yl]sulfanyl}propanoic acid |
| Synonyms | Source |
|---|---|
| 3-(pregn-4-ene-3,20-dione-7α-yl)thiopropanoic acid | ChEBI |
| 7-(Carboxyethylthio)progesterone | ChemIDplus |
| 7α-(carboxyethylthio)-P4 | ChEBI |
| 7α-(carboxyethylthio)progesterone | ChEBI |
| 7α-CET-P4 | ChEBI |
| P4-7α-CET | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7357523 | Reaxys |
| CAS:40845-01-0 | ChemIDplus |
| Citations |
|---|