EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:10110 - zidovudine
| Formula | C10H13N5O4 |
| Net Charge | 0 |
| Average Mass | 267.245 |
| Monoisotopic Mass | 267.09675 |
| SMILES | Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](CO)O2)c(=O)nc1=O |
| InChI | InChI=1S/C10H13N5O4/c1-5-3-15(10(18)12-9(5)17)8-2-6(13-14-11)7(4-16)19-8/h3,6-8,16H,2,4H2,1H3,(H,12,17,18)/t6-,7+,8+/m0/s1 |
| InChIKey | HBOMLICNUCNMMY-XLPZGREQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. antiviral agent A substance that destroys or inhibits replication of viruses. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zidovudine (CHEBI:10110) has role anti-HIV agent (CHEBI:64946) |
| zidovudine (CHEBI:10110) has role antifungal agent (CHEBI:35718) |
| zidovudine (CHEBI:10110) has role antiinfective agent (CHEBI:35441) |
| zidovudine (CHEBI:10110) has role antimetabolite (CHEBI:35221) |
| zidovudine (CHEBI:10110) has role antineoplastic agent (CHEBI:35610) |
| zidovudine (CHEBI:10110) has role antitubercular agent (CHEBI:33231) |
| zidovudine (CHEBI:10110) has role antiviral agent (CHEBI:22587) |
| zidovudine (CHEBI:10110) has role antiviral drug (CHEBI:36044) |
| zidovudine (CHEBI:10110) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| zidovudine (CHEBI:10110) is a azide (CHEBI:22680) |
| zidovudine (CHEBI:10110) is a pyrimidine 2',3'-dideoxyribonucleoside (CHEBI:48441) |
| IUPAC Name |
|---|
| 3'-azido-3'-deoxythymidine |
| INNs | Source |
|---|---|
| zidovudina | WHO MedNet |
| zidovudine | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 3'-azt | ChEMBL |
| Azidothymidine | ChemIDplus |
| AZT | KEGG COMPOUND |
| Bwa509u | ChEMBL |
| BW A509U | ChEMBL |
| BW-A-509U | ChEMBL |
| Brand Names | Source |
|---|---|
| Retrovir | KEGG DRUG |
| Zidovudine component of combivir | ChEMBL |
| Zidovudine component of lamivudine/ teva | ChEMBL |
| Zidovudine component of trizivir | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:763034 | Beilstein |
| CAS:30516-87-1 | ChemIDplus |
| CAS:30516-87-1 | KEGG COMPOUND |
| CAS:30516-87-1 | DrugBank |
| CAS:30516-87-1 | KEGG DRUG |
| Citations |
|---|