EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N5O4 |
| Net Charge | 0 |
| Average Mass | 267.245 |
| Monoisotopic Mass | 267.09675 |
| SMILES | Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](CO)O2)c(=O)nc1=O |
| InChI | InChI=1S/C10H13N5O4/c1-5-3-15(10(18)12-9(5)17)8-2-6(13-14-11)7(4-16)19-8/h3,6-8,16H,2,4H2,1H3,(H,12,17,18)/t6-,7+,8+/m0/s1 |
| InChIKey | HBOMLICNUCNMMY-XLPZGREQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zidovudine (CHEBI:10110) has role antimetabolite (CHEBI:35221) |
| zidovudine (CHEBI:10110) has role antiviral drug (CHEBI:36044) |
| zidovudine (CHEBI:10110) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| zidovudine (CHEBI:10110) is a azide (CHEBI:22680) |
| zidovudine (CHEBI:10110) is a pyrimidine 2',3'-dideoxyribonucleoside (CHEBI:48441) |
| IUPAC Name |
|---|
| 3'-azido-3'-deoxythymidine |
| INN | Source |
|---|---|
| zidovudine | KEGG DRUG |
| Synonyms | Source |
|---|---|
| Azidothymidine | ChemIDplus |
| AZT | KEGG COMPOUND |
| Zidovudin | ChemIDplus |
| Zidovudinum | ChemIDplus |
| Brand Name | Source |
|---|---|
| Retrovir | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:763034 | Beilstein |
| CAS:30516-87-1 | KEGG COMPOUND |
| CAS:30516-87-1 | KEGG DRUG |
| CAS:30516-87-1 | DrugBank |
| CAS:30516-87-1 | ChemIDplus |
| Citations |
|---|