EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11BrN2O2 |
| Net Charge | 0 |
| Average Mass | 283.125 |
| Monoisotopic Mass | 282.00039 |
| SMILES | [NH3+][C@@H](Cc1cnc2cc(Br)ccc12)C(=O)[O-] |
| InChI | InChI=1S/C11H11BrN2O2/c12-7-1-2-8-6(3-9(13)11(15)16)5-14-10(8)4-7/h1-2,4-5,9,14H,3,13H2,(H,15,16)/t9-/m0/s1 |
| InChIKey | OAORYCZPERQARS-VIFPVBQESA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-6'-bromotryptophan zwitterion (CHEBI:61893) is a L-α-amino acid zwitterion (CHEBI:59869) |
| L-6'-bromotryptophan zwitterion (CHEBI:61893) is a aromatic L-α-amino acid zwitterion (CHEBI:84824) |
| L-6'-bromotryptophan zwitterion (CHEBI:61893) is tautomer of L-6'-bromotryptophan (CHEBI:47276) |
| Incoming Relation(s) |
| L-6'-bromotryptophan (CHEBI:47276) is tautomer of L-6'-bromotryptophan zwitterion (CHEBI:61893) |
| IUPAC Name |
|---|
| (2S)-2-ammonio-3-(6-bromo-1H-indol-3-yl)propanoate |
| Synonym | Source |
|---|---|
| 6-bromo-L-tryptophan zwitterion | ChEBI |