EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11BrN2O2 |
| Net Charge | 0 |
| Average Mass | 283.125 |
| Monoisotopic Mass | 282.00039 |
| SMILES | N[C@@H](Cc1cnc2cc(Br)ccc12)C(=O)O |
| InChI | InChI=1S/C11H11BrN2O2/c12-7-1-2-8-6(3-9(13)11(15)16)5-14-10(8)4-7/h1-2,4-5,9,14H,3,13H2,(H,15,16)/t9-/m0/s1 |
| InChIKey | OAORYCZPERQARS-VIFPVBQESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-6'-bromotryptophan (CHEBI:47276) is a L-tryptophan derivative (CHEBI:47994) |
| L-6'-bromotryptophan (CHEBI:47276) is a bromoamino acid (CHEBI:22930) |
| L-6'-bromotryptophan (CHEBI:47276) is a bromoindole (CHEBI:52514) |
| L-6'-bromotryptophan (CHEBI:47276) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-6'-bromotryptophan (CHEBI:47276) is tautomer of L-6'-bromotryptophan zwitterion (CHEBI:61893) |
| Incoming Relation(s) |
| L-6'-bromotryptophan residue (CHEBI:61899) is substituent group from L-6'-bromotryptophan (CHEBI:47276) |
| L-6'-bromotryptophan zwitterion (CHEBI:61893) is tautomer of L-6'-bromotryptophan (CHEBI:47276) |
| IUPAC Name |
|---|
| 6-bromo-L-tryptophan |
| Synonym | Source |
|---|---|
| (S)-2-amino-3-(6-bromo-1H-indol-3-yl)propanoic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| BTR | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4691296 | Beilstein |
| Reaxys:4691296 | Reaxys |
| Citations |
|---|