EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24N4O9S |
| Net Charge | -4 |
| Average Mass | 532.531 |
| Monoisotopic Mass | 532.12859 |
| SMILES | *NC(=O)[C@H](CSCc1nc(Cc2ncc(CCC(=O)[O-])c2CC(=O)[O-])c(CCC(=O)[O-])c1CC(=O)[O-])N* |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dipyrrolylmethanemethyl-L-cysteine residue(4−) (CHEBI:61892) is a tetracarboxylic acid anion (CHEBI:35754) |
| dipyrrolylmethanemethyl-L-cysteine residue(4−) (CHEBI:61892) is conjugate base of dipyrrolylmethanemethyl-L-cysteine residue (CHEBI:23842) |
| Incoming Relation(s) |
| dipyrrolylmethanemethyl-L-cysteine residue (CHEBI:23842) is conjugate acid of dipyrrolylmethanemethyl-L-cysteine residue(4−) (CHEBI:61892) |
| Synonyms | Source |
|---|---|
| dipyrrolylmethyl-L-cysteine residue(4−) | ChEBI |
| dipyrrolylmethyl-L-cysteine(4−) | ChEBI |
| dipyrromethane cofactor(4−) | ChEBI |
| dipyrrole cofactor(4−) | ChEBI |
| pyrromethane cofactor(4−) | ChEBI |
| UniProt Name | Source |
|---|---|
| dipyrrolylmethanemethyl-L-cysteine residue | UniProt |
| Manual Xrefs | Databases |
|---|---|
| AA0252 | RESID |
| Citations |
|---|