EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28N4O9S |
| Net Charge | 0 |
| Average Mass | 536.563 |
| Monoisotopic Mass | 536.15770 |
| SMILES | *NC(=O)[C@H](CSCc1nc(Cc2ncc(CCC(=O)O)c2CC(=O)O)c(CCC(=O)O)c1CC(=O)O)N* |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dipyrrolylmethanemethyl-L-cysteine residue (CHEBI:23842) has functional parent L-cysteine residue (CHEBI:29950) |
| dipyrrolylmethanemethyl-L-cysteine residue (CHEBI:23842) is a L-α-amino acid residue (CHEBI:83228) |
| dipyrrolylmethanemethyl-L-cysteine residue (CHEBI:23842) is conjugate acid of dipyrrolylmethanemethyl-L-cysteine residue(4−) (CHEBI:61892) |
| Incoming Relation(s) |
| dipyrrolylmethanemethyl-L-cysteine residue(4−) (CHEBI:61892) is conjugate base of dipyrrolylmethanemethyl-L-cysteine residue (CHEBI:23842) |
| Synonyms | Source |
|---|---|
| dipyrrolylmethanemethyl-L-cysteine | ChEBI |
| dipyrromethane cofactor | RESID |
| dipyrromethane cofactor | ChEBI |
| dipyrrole cofactor | ChEBI |
| dipyrrolylmethyl-L-cysteine residue | ChEBI |
| pyrromethane cofactor | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| AA0252 | RESID |
| Citations |
|---|