EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O5 |
| Net Charge | 0 |
| Average Mass | 150.130 |
| Monoisotopic Mass | 150.05282 |
| SMILES | [H]C(=O)[C@H](O)[C@@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[o211h]/1/ |
| InChI | InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4-,5+/m0/s1 |
| InChIKey | PYMYPHUHKUWMLA-VAYJURFESA-N |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. fundamental metabolite Any metabolite produced by all living cells. fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aldehydo-L-arabinose (CHEBI:6182) is a aldehydo-arabinose (CHEBI:46982) |
| aldehydo-L-arabinose (CHEBI:6182) is a L-arabinose (CHEBI:30849) |
| aldehydo-L-arabinose (CHEBI:6182) is enantiomer of aldehydo-D-arabinose (CHEBI:46983) |
| Incoming Relation(s) |
| aldehydo-D-arabinose (CHEBI:46983) is enantiomer of aldehydo-L-arabinose (CHEBI:6182) |
| IUPAC Names |
|---|
| aldehydo-L-arabinose |
| aldehydo-L-arabino-pentose |
| Synonyms | Source |
|---|---|
| (2R,3S,4S)-2,3,4,5-tetrahydroxypentanal | IUPAC |
| L-Arabinose | KEGG COMPOUND |
| Citations |
|---|