EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O5 |
| Net Charge | 0 |
| Average Mass | 150.130 |
| Monoisotopic Mass | 150.05282 |
| SMILES | [H]C(=O)[C@H](O)[C@@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[o211h]/1/ |
| InChI | InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4-,5+/m0/s1 |
| InChIKey | PYMYPHUHKUWMLA-VAYJURFESA-N |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). fundamental metabolite Any metabolite produced by all living cells. fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aldehydo-L-arabinose (CHEBI:6182) is a aldehydo-arabinose (CHEBI:46982) |
| aldehydo-L-arabinose (CHEBI:6182) is a L-arabinose (CHEBI:30849) |
| aldehydo-L-arabinose (CHEBI:6182) is enantiomer of aldehydo-D-arabinose (CHEBI:46983) |
| Incoming Relation(s) |
| aldehydo-D-arabinose (CHEBI:46983) is enantiomer of aldehydo-L-arabinose (CHEBI:6182) |
| IUPAC Names |
|---|
| aldehydo-L-arabinose |
| aldehydo-L-arabino-pentose |
| Synonyms | Source |
|---|---|
| (2R,3S,4S)-2,3,4,5-tetrahydroxypentanal | IUPAC |
| L-Arabinose | KEGG COMPOUND |
| Citations |
|---|