EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O5 |
| Net Charge | 0 |
| Average Mass | 150.130 |
| Monoisotopic Mass | 150.05282 |
| SMILES | [H]C(=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[o122h]/1/ |
| InChI | InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4-,5+/m1/s1 |
| InChIKey | PYMYPHUHKUWMLA-WDCZJNDASA-N |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). fundamental metabolite Any metabolite produced by all living cells. fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aldehydo-D-arabinose (CHEBI:46983) is a aldehydo-arabinose (CHEBI:46982) |
| aldehydo-D-arabinose (CHEBI:46983) is a D-arabinose (CHEBI:17108) |
| aldehydo-D-arabinose (CHEBI:46983) is enantiomer of aldehydo-L-arabinose (CHEBI:6182) |
| Incoming Relation(s) |
| aldehydo-L-arabinose (CHEBI:6182) is enantiomer of aldehydo-D-arabinose (CHEBI:46983) |
| IUPAC Names |
|---|
| aldehydo-D-arabinose |
| aldehydo-D-arabino-pentose |
| Synonyms | Source |
|---|---|
| (2S,3R,4R)-2,3,4,5-tetrahydroxypentanal | IUPAC |
| D-arabinose | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| G16391NR | GlyTouCan |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1603913 | Gmelin |
| Beilstein:1723079 | Beilstein |
| Beilstein:5244984 | Beilstein |
| CAS:10323-20-3 | NIST Chemistry WebBook |
| CAS:10323-20-3 | ChemIDplus |