EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:61699 - (−)-α-gurjunene
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@]12CCC(C)=C1[C@]1([H])C(C)(C)[C@]1([H])CC[C@H]2C |
| InChI | InChI=1S/C15H24/c1-9-6-8-12-14(15(12,3)4)13-10(2)5-7-11(9)13/h9,11-12,14H,5-8H2,1-4H3/t9-,11-,12-,14-/m1/s1 |
| InChIKey | SPCXZDDGSGTVAW-XIDUGBJDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anaphalis nubigena (ncbitaxon:595329) | - | PubMed (19731610) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-α-gurjunene (CHEBI:61699) has role antibacterial agent (CHEBI:33282) |
| (−)-α-gurjunene (CHEBI:61699) has role plant metabolite (CHEBI:76924) |
| (−)-α-gurjunene (CHEBI:61699) has role volatile oil component (CHEBI:27311) |
| (−)-α-gurjunene (CHEBI:61699) is a carbotricyclic compound (CHEBI:38032) |
| (−)-α-gurjunene (CHEBI:61699) is a sesquiterpene (CHEBI:35189) |
| (−)-α-gurjunene (CHEBI:61699) is enantiomer of (+)-α-gurjunene (CHEBI:132832) |
| Incoming Relation(s) |
| 5-hydroxy-α-gurjunene (CHEBI:138167) has functional parent (−)-α-gurjunene (CHEBI:61699) |
| (+)-α-gurjunene (CHEBI:132832) is enantiomer of (−)-α-gurjunene (CHEBI:61699) |
| IUPAC Name |
|---|
| (1aR,4R,4aR,7bS)-1,1,4,7-tetramethyl-1a,2,3,4,4a,5,6,7b-octahydro-1H-cyclopropa[e]azulene |
| UniProt Name | Source |
|---|---|
| (−)-α-gurjunene | UniProt |
| Citations |
|---|