EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12C3=C(C)CC[C@@]3([H])[C@@H](C)CC[C@]1([H])C2(C)C |
| InChI | InChI=1S/C15H24/c1-9-6-8-12-14(15(12,3)4)13-10(2)5-7-11(9)13/h9,11-12,14H,5-8H2,1-4H3/t9-,11-,12-,14-/m0/s1 |
| InChIKey | SPCXZDDGSGTVAW-HVTMNAMFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Conocephalum conicum (ncbitaxon:41839) | - | Article (Phytochem., (1999), 51, 277) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-α-gurjunene (CHEBI:132832) has role plant metabolite (CHEBI:76924) |
| (+)-α-gurjunene (CHEBI:132832) is a carbotricyclic compound (CHEBI:38032) |
| (+)-α-gurjunene (CHEBI:132832) is a polycyclic olefin (CHEBI:35714) |
| (+)-α-gurjunene (CHEBI:132832) is a sesquiterpene (CHEBI:35189) |
| (+)-α-gurjunene (CHEBI:132832) is enantiomer of (−)-α-gurjunene (CHEBI:61699) |
| Incoming Relation(s) |
| (−)-α-gurjunene (CHEBI:61699) is enantiomer of (+)-α-gurjunene (CHEBI:132832) |
| IUPAC Name |
|---|
| (1aS,4S,4aS,7bR)-1,1,4,7-tetramethyl-1a,2,3,4,4a,5,6,7b-octahydro-1H-cyclopropa[e]azulene |
| Synonym | Source |
|---|---|
| (+)-alpha-Gurjunene | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C00038071 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6791884 | Reaxys |
| CAS:67650-50-4 | KNApSAcK |