EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:61670 - oroxylin A 7-O-β-D-glucuronide
| Formula | C22H20O11 |
| Net Charge | 0 |
| Average Mass | 460.391 |
| Monoisotopic Mass | 460.10056 |
| SMILES | COc1c(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)cc2oc(-c3ccccc3)cc(=O)c2c1O |
| InChI | InChI=1S/C22H20O11/c1-30-19-13(32-22-18(27)16(25)17(26)20(33-22)21(28)29)8-12-14(15(19)24)10(23)7-11(31-12)9-5-3-2-4-6-9/h2-8,16-18,20,22,24-27H,1H3,(H,28,29)/t16-,17-,18+,20-,22+/m0/s1 |
| InChIKey | QXIPXNZUEQYPLZ-QSUZLTIMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scutellaria baicalensis (ncbitaxon:65409) | - | PubMed (19829679) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oroxylin A 7-O-β-D-glucuronide (CHEBI:61670) has functional parent oroxylin A (CHEBI:61668) |
| oroxylin A 7-O-β-D-glucuronide (CHEBI:61670) has role plant metabolite (CHEBI:76924) |
| oroxylin A 7-O-β-D-glucuronide (CHEBI:61670) is a glycosyloxyflavone (CHEBI:50018) |
| oroxylin A 7-O-β-D-glucuronide (CHEBI:61670) is a monohydroxyflavone (CHEBI:38687) |
| oroxylin A 7-O-β-D-glucuronide (CHEBI:61670) is a monomethoxyflavone (CHEBI:25401) |
| oroxylin A 7-O-β-D-glucuronide (CHEBI:61670) is a monosaccharide derivative (CHEBI:63367) |
| oroxylin A 7-O-β-D-glucuronide (CHEBI:61670) is a β-D-glucosiduronic acid (CHEBI:15341) |
| oroxylin A 7-O-β-D-glucuronide (CHEBI:61670) is conjugate acid of oroxylin A 7-O-β-D-glucuronate (CHEBI:61674) |
| Incoming Relation(s) |
| oroxylin A 7-O-β-D-glucuronate (CHEBI:61674) is conjugate base of oroxylin A 7-O-β-D-glucuronide (CHEBI:61670) |
| IUPAC Name |
|---|
| 5-hydroxy-6-methoxy-4-oxo-2-phenyl-4H-chromen-7-yl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| oroxylin 7-O-β-D-glucuronide | ChEBI |
| 5-hydroxy-6-methoxy-flavone-7-yl β-D-glucopyranosiduronic acid | ChEBI |
| 5,7-dihydroxy-6-methoxyflavone 7-O-β-D-glucuronide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:71387 | Reaxys |
| Citations |
|---|