EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O5 |
| Net Charge | 0 |
| Average Mass | 284.267 |
| Monoisotopic Mass | 284.06847 |
| SMILES | COc1c(O)cc2oc(-c3ccccc3)cc(=O)c2c1O |
| InChI | InChI=1S/C16H12O5/c1-20-16-11(18)8-13-14(15(16)19)10(17)7-12(21-13)9-5-3-2-4-6-9/h2-8,18-19H,1H3 |
| InChIKey | LKOJGSWUMISDOF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oroxylin A (CHEBI:61668) has role antineoplastic agent (CHEBI:35610) |
| oroxylin A (CHEBI:61668) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| oroxylin A (CHEBI:61668) is a dihydroxyflavone (CHEBI:38686) |
| oroxylin A (CHEBI:61668) is a monomethoxyflavone (CHEBI:25401) |
| oroxylin A (CHEBI:61668) is conjugate acid of oroxylin A(1−) (CHEBI:77939) |
| Incoming Relation(s) |
| oroxylin A 7-O-β-D-glucuronide (CHEBI:61670) has functional parent oroxylin A (CHEBI:61668) |
| oroxylin A(1−) (CHEBI:77939) is conjugate base of oroxylin A (CHEBI:61668) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-6-methoxy-2-phenyl-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 5,7-dihydroxy-6-methoxy-2-phenyl-4H-1-benzopyran-4-one | ChEBI |
| 5,7-dihydroxy-6-methoxyflavone | ChEBI |
| baicalein 6-methyl ether | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-12734 | MetaCyc |
| LMPK12111096 | LIPID MAPS |
| Oroxylin_A | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:281274 | Reaxys |
| CAS:480-11-5 | ChemIDplus |
| Citations |
|---|