EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H25O10P3 |
| Net Charge | -4 |
| Average Mass | 458.277 |
| Monoisotopic Mass | 458.06825 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-] |
| InChI | InChI=1S/C15H29O10P3/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-23-27(19,20)25-28(21,22)24-26(16,17)18/h7,9,11H,5-6,8,10,12H2,1-4H3,(H,19,20)(H,21,22)(H2,16,17,18)/p-4/b14-9+,15-11+ |
| InChIKey | QIOOKVHMPPJVHS-YFVJMOTDSA-J |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| farnesyl triphosphate(4−) (CHEBI:61563) is a organophosphate oxoanion (CHEBI:58945) |
| farnesyl triphosphate(4−) (CHEBI:61563) is conjugate base of farnesyl triphosphate(3−) (CHEBI:58331) |
| Incoming Relation(s) |
| farnesyl triphosphate(3−) (CHEBI:58331) is conjugate acid of farnesyl triphosphate(4−) (CHEBI:61563) |
| IUPAC Name |
|---|
| (2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrien-1-yl triphosphate |
| Synonym | Source |
|---|---|
| farnesyl triphosphate tetraanion | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (2E,6E)-farnesyl triphosphate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-491 | MetaCyc |