EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O10P3 |
| Net Charge | -3 |
| Average Mass | 459.285 |
| Monoisotopic Mass | 459.07553 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])O |
| InChI | InChI=1S/C15H29O10P3/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-23-27(19,20)25-28(21,22)24-26(16,17)18/h7,9,11H,5-6,8,10,12H2,1-4H3,(H,19,20)(H,21,22)(H2,16,17,18)/p-3/b14-9+,15-11+ |
| InChIKey | QIOOKVHMPPJVHS-YFVJMOTDSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| farnesyl triphosphate(3−) (CHEBI:58331) is a organophosphate oxoanion (CHEBI:58945) |
| farnesyl triphosphate(3−) (CHEBI:58331) is conjugate acid of farnesyl triphosphate(4−) (CHEBI:61563) |
| farnesyl triphosphate(3−) (CHEBI:58331) is conjugate base of farnesyl triphosphate (CHEBI:17961) |
| Incoming Relation(s) |
| farnesyl triphosphate (CHEBI:17961) is conjugate acid of farnesyl triphosphate(3−) (CHEBI:58331) |
| farnesyl triphosphate(4−) (CHEBI:61563) is conjugate base of farnesyl triphosphate(3−) (CHEBI:58331) |
| Synonym | Source |
|---|---|
| farnesyl triphosphate trianion | ChEBI |