EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11N2O14P3 |
| Net Charge | -4 |
| Average Mass | 464.109 |
| Monoisotopic Mass | 463.94451 |
| SMILES | O=c1ccn([C@H]2C[C@H](O)[C@@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])O2)c(=O)n1 |
| InChI | InChI=1S/C9H15N2O14P3/c12-5-3-8(11-2-1-7(13)10-9(11)14)23-6(5)4-22-27(18,19)25-28(20,21)24-26(15,16)17/h1-2,5-6,8,12H,3-4H2,(H,18,19)(H,20,21)(H,10,13,14)(H2,15,16,17)/p-4/t5-,6+,8+/m0/s1 |
| InChIKey | AHCYMLUZIRLXAA-SHYZEUOFSA-J |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dUTP(4−) (CHEBI:61555) is a 2'-deoxyribonucleoside 5'-triphosphate(4−) (CHEBI:61560) |
| dUTP(4−) (CHEBI:61555) is conjugate base of dUTP(3−) (CHEBI:58212) |
| Incoming Relation(s) |
| dUTP(3−) (CHEBI:58212) is conjugate acid of dUTP(4−) (CHEBI:61555) |
| IUPAC Name |
|---|
| 2'-deoxy-5'-O-({[(phosphonatooxy)phosphinato]oxy}phosphinato)uridine |
| Synonyms | Source |
|---|---|
| 2'-deoxyuridine-5'-triphosphate | ChEBI |
| 2'-deoxyuridine-5'-triphosphate(4−) | SUBMITTER |
| 2'-deoxyuridine-5'-triphosphate tetraanion | ChEBI |
| deoxyuridine-triphosphate(4−) | SUBMITTER |
| deoxy-UTP(4−) | SUBMITTER |
| dUTP tetraanion | ChEBI |
| UniProt Name | Source |
|---|---|
| dUTP | UniProt |
| Manual Xrefs | Databases |
|---|---|
| DUTP | MetaCyc |