EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N2O14P3 |
| Net Charge | -3 |
| Average Mass | 465.117 |
| Monoisotopic Mass | 464.95178 |
| SMILES | O=c1ccn([C@H]2C[C@H](O)[C@@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])O)O2)c(=O)n1 |
| InChI | InChI=1S/C9H15N2O14P3/c12-5-3-8(11-2-1-7(13)10-9(11)14)23-6(5)4-22-27(18,19)25-28(20,21)24-26(15,16)17/h1-2,5-6,8,12H,3-4H2,(H,18,19)(H,20,21)(H,10,13,14)(H2,15,16,17)/p-3/t5-,6+,8+/m0/s1 |
| InChIKey | AHCYMLUZIRLXAA-SHYZEUOFSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dUTP(3−) (CHEBI:58212) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| dUTP(3−) (CHEBI:58212) is a 2'-deoxyribonucleoside triphosphate oxoanion (CHEBI:61662) |
| dUTP(3−) (CHEBI:58212) is conjugate acid of dUTP(4−) (CHEBI:61555) |
| dUTP(3−) (CHEBI:58212) is conjugate base of dUTP (CHEBI:17625) |
| Incoming Relation(s) |
| dUTP (CHEBI:17625) is conjugate acid of dUTP(3−) (CHEBI:58212) |
| dUTP(4−) (CHEBI:61555) is conjugate base of dUTP(3−) (CHEBI:58212) |
| IUPAC Name |
|---|
| 2'-deoxy-5'-O-[({[(hydroxyphosphinato)oxy]phosphinato}oxy)phosphinato]uridine |
| Synonyms | Source |
|---|---|
| dUTP trianion | ChEBI |
| 2'-deoxyuridine 5'-triphosphate trianion | ChEBI |
| 2'-deoxyuridine 5'-triphosphate(3−) | ChEBI |