EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13O9P |
| Net Charge | 0 |
| Average Mass | 260.135 |
| Monoisotopic Mass | 260.02972 |
| SMILES | O=P(O)(O)OC[C@H]1OC(O)(CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13O9P/c7-2-6(10)5(9)4(8)3(15-6)1-14-16(11,12)13/h3-5,7-10H,1-2H2,(H2,11,12,13)/t3-,4-,5+,6?/m1/s1 |
| InChIKey | BGWGXPAPYGQALX-VRPWFDPXSA-N |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-fructofuranose 6-phosphate (CHEBI:61553) is a D-fructose 6-phosphate (CHEBI:78697) |
| D-fructofuranose 6-phosphate (CHEBI:61553) is conjugate acid of D-fructofuranose 6-phosphate(2−) (CHEBI:61527) |
| Incoming Relation(s) |
| β-D-fructofuranose 6-phosphate (CHEBI:16084) is a D-fructofuranose 6-phosphate (CHEBI:61553) |
| D-fructofuranose 6-phosphate(2−) (CHEBI:61527) is conjugate base of D-fructofuranose 6-phosphate (CHEBI:61553) |
| IUPAC Name |
|---|
| D-fructofuranose 6-phosphate |
| Synonyms | Source |
|---|---|
| Neuberg ester | KEGG COMPOUND |
| D-Fructose 6-phosphoric acid | KEGG COMPOUND |
| D-Fructose 6-phosphate | KEGG COMPOUND |
| 6-O-phosphono-D-fructofuranose | IUPAC |
| Citations |
|---|