EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11O9P |
| Net Charge | -2 |
| Average Mass | 258.119 |
| Monoisotopic Mass | 258.01517 |
| SMILES | O=P([O-])([O-])OC[C@H]1OC(O)(CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13O9P/c7-2-6(10)5(9)4(8)3(15-6)1-14-16(11,12)13/h3-5,7-10H,1-2H2,(H2,11,12,13)/p-2/t3-,4-,5+,6?/m1/s1 |
| InChIKey | BGWGXPAPYGQALX-VRPWFDPXSA-L |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-fructofuranose 6-phosphate(2−) (CHEBI:61527) has functional parent D-fructofuranose (CHEBI:37721) |
| D-fructofuranose 6-phosphate(2−) (CHEBI:61527) has role fundamental metabolite (CHEBI:78675) |
| D-fructofuranose 6-phosphate(2−) (CHEBI:61527) is a organophosphate oxoanion (CHEBI:58945) |
| D-fructofuranose 6-phosphate(2−) (CHEBI:61527) is conjugate base of D-fructofuranose 6-phosphate (CHEBI:61553) |
| Incoming Relation(s) |
| α-D-fructofuranose 6-phosphate(2−) (CHEBI:234464) is a D-fructofuranose 6-phosphate(2−) (CHEBI:61527) |
| β-D-fructofuranose 6-phosphate(2−) (CHEBI:57634) is a D-fructofuranose 6-phosphate(2−) (CHEBI:61527) |
| D-fructofuranose 6-phosphate (CHEBI:61553) is conjugate acid of D-fructofuranose 6-phosphate(2−) (CHEBI:61527) |
| IUPAC Name |
|---|
| 6-O-phosphonato-D-fructofuranose |
| Synonyms | Source |
|---|---|
| D-fructofuranose 6-phosphate dianion | SUBMITTER |
| D-fructofuranose 6-phosphate | ChEBI |
| UniProt Name | Source |
|---|---|
| D-fructose 6-phosphate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4909407 | Reaxys |