EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7NO3 |
| Net Charge | 0 |
| Average Mass | 153.137 |
| Monoisotopic Mass | 153.04259 |
| SMILES | [H][C@]12CC=C(C(=O)O)N1C(=O)C2 |
| InChI | InChI=1S/C7H7NO3/c9-6-3-4-1-2-5(7(10)11)8(4)6/h2,4H,1,3H2,(H,10,11)/t4-/m1/s1 |
| InChIKey | BSIMZHVOQZIAOY-SCSAIBSYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-carbapenem-3-carboxylic acid (CHEBI:615) is a carbapenemcarboxylic acid (CHEBI:46634) |
| 1-carbapenem-3-carboxylic acid (CHEBI:615) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| 1-carbapenem-3-carboxylic acid (CHEBI:615) is conjugate acid of (5R)-carbapenem-3-carboxylate (CHEBI:73943) |
| Incoming Relation(s) |
| (5R)-carbapenem-3-carboxylate (CHEBI:73943) is conjugate base of 1-carbapenem-3-carboxylic acid (CHEBI:615) |
| IUPAC Name |
|---|
| 2,3-didehydro-1-carbapenam-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| 1-Carbapen-2-em-3-carboxylic acid | KEGG COMPOUND |
| (5R)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid | IUPAC |
| (5R)-Carbapenem-3-carboxylate | KEGG COMPOUND |
| (5R)-Carbapenem-3-carboxylic acid | KEGG COMPOUND |
| carbapenem-3-carboxylic acid | ChemIDplus |
| SQ 27860 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8832318 | Reaxys |
| CAS:82768-37-4 | ChemIDplus |